C17H19Cl2N5O — CID 16667051
4-chloro-7-[(4-chloro-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]-5-propan-2-ylpyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 16667051) has the molecular formula C17H19Cl2N5O and a molecular weight of 380.28 g/mol. Its IUPAC name is 4-chloro-7-[(4-chloro-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]-5-propan-2-ylpyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-chloro-7-[(4-chloro-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]-5-propan-2-ylpyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 16667051 |
| Molecular Formula | C17H19Cl2N5O |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 4-chloro-7-[(4-chloro-3,5-dimethyl-1-oxidopyridin-1-ium-2-yl)methyl]-5-propan-2-ylpyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1c[n+]([O-])c(Cn2cc(C(C)C)c3c(Cl)nc(N)nc32)c(C)c1Cl |
| InChI | InChI=1S/C17H19Cl2N5O/c1-8(2)11-6-23(16-13(11)15(19)21-17(20)22-16)7-12-10(4)14(18)9(3)5-24(12)25/h5-6,8H,7H2,1-4H3,(H2,20,21,22) |
| InChIKey | BEODOKLZFCXBCQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|