About 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene
1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene (PubChem CID 166670961) has the molecular formula C17H24ClFS
and a molecular weight of 314.90 g/mol. Its IUPAC name is 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene.
Molecular Properties
| Compound Name | 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene |
| PubChem CID | 166670961 |
| Molecular Formula | C17H24ClFS |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene |
| SMILES | C=C(C)CC(C)C(SC)c1cc(Cl)c(CC)c(C)c1F |
| InChI | InChI=1S/C17H24ClFS/c1-7-13-12(5)16(19)14(9-15(13)18)17(20-6)11(4)8-10(2)3/h9,11,17H,2,7-8H2,1,3-6H3 |
| InChIKey | MLNXYMVQLYVJSM-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene?
The IUPAC name of 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene (CID 166670961) is 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene.
What is the SMILES notation for 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene?
The canonical SMILES for 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene is C=C(C)CC(C)C(SC)c1cc(Cl)c(CC)c(C)c1F.
What is the InChIKey of 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene?
The InChIKey is MLNXYMVQLYVJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24ClFS/c1-7-13-12(5)16(19)14(9-15(13)18)17(20-6)11(4)8-10(2)3/h9,11,17H,2,7-8H2,1,3-6H3.
What are the key properties of 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene?
1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene has a molecular weight of 314.90 g/mol, XLogP of 6.36, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-(2,4-dimethyl-1-methylsulfanylpent-4-enyl)-2-ethyl-4-fluoro-3-methylbenzene is sourced from PubChem (CID 166670961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).