C17H20O2 — CID 166670988
5-(2-cyclohexa-1,5-dien-1-ylethoxy)-6-methylcyclohepta-1,4,6-triene-1-carbaldehyde (PubChem CID 166670988) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 5-(2-cyclohexa-1,5-dien-1-ylethoxy)-6-methylcyclohepta-1,4,6-triene-1-carbaldehyde.
| Compound Name | 5-(2-cyclohexa-1,5-dien-1-ylethoxy)-6-methylcyclohepta-1,4,6-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 166670988 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 5-(2-cyclohexa-1,5-dien-1-ylethoxy)-6-methylcyclohepta-1,4,6-triene-1-carbaldehyde |
| SMILES | CC1=CC(C=O)=CCC=C1OCCC1=CCCC=C1 |
| InChI | InChI=1S/C17H20O2/c1-14-12-16(13-18)8-5-9-17(14)19-11-10-15-6-3-2-4-7-15/h3,6-9,12-13H,2,4-5,10-11H2,1H3 |
| InChIKey | NGARHOCWJGHURK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|