About 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide
2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide (PubChem CID 166671176) has the molecular formula C13H15ClN4O
and a molecular weight of 278.74 g/mol. Its IUPAC name is 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide |
| PubChem CID | 166671176 |
| Molecular Formula | C13H15ClN4O |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1c(Cl)cccc1-n1cncn1 |
| InChI | InChI=1S/C13H15ClN4O/c1-3-17(4-2)13(19)12-10(14)6-5-7-11(12)18-9-15-8-16-18/h5-9H,3-4H2,1-2H3 |
| InChIKey | CDJWLVFIZQONKF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide?
The IUPAC name of 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide (CID 166671176) is 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide.
What is the SMILES notation for 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide?
The canonical SMILES for 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide is CCN(CC)C(=O)c1c(Cl)cccc1-n1cncn1.
What is the InChIKey of 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide?
The InChIKey is CDJWLVFIZQONKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN4O/c1-3-17(4-2)13(19)12-10(14)6-5-7-11(12)18-9-15-8-16-18/h5-9H,3-4H2,1-2H3.
What are the key properties of 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide?
2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide has a molecular weight of 278.74 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N,N-diethyl-6-(1,2,4-triazol-1-yl)benzamide is sourced from PubChem (CID 166671176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).