C25H19ClN2 — CID 166671183
2-(4-chlorophenyl)-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,10-phenanthroline (PubChem CID 166671183) has the molecular formula C25H19ClN2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,10-phenanthroline.
| Compound Name | 2-(4-chlorophenyl)-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 166671183 |
| Molecular Formula | C25H19ClN2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-(4-chlorophenyl)-9-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-1,10-phenanthroline |
| SMILES | C=C/C=C\C=C(/C)c1ccc2ccc3ccc(-c4ccc(Cl)cc4)nc3c2n1 |
| InChI | InChI=1S/C25H19ClN2/c1-3-4-5-6-17(2)22-15-11-19-7-8-20-12-16-23(28-25(20)24(19)27-22)18-9-13-21(26)14-10-18/h3-16H,1H2,2H3/b5-4-,17-6+ |
| InChIKey | ZUVBRUWJXKVACA-JCFRVBNTSA-N |
| XLogP | 7.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|