C9H18F3N — CID 166671386
1,1,1-trifluoro-2,4,4-trimethylhexan-2-amine (PubChem CID 166671386) has the molecular formula C9H18F3N and a molecular weight of 197.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,4,4-trimethylhexan-2-amine.
| Compound Name | 1,1,1-trifluoro-2,4,4-trimethylhexan-2-amine |
|---|---|
| PubChem CID | 166671386 |
| Molecular Formula | C9H18F3N |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1,1,1-trifluoro-2,4,4-trimethylhexan-2-amine |
| SMILES | CCC(C)(C)CC(C)(N)C(F)(F)F |
| InChI | InChI=1S/C9H18F3N/c1-5-7(2,3)6-8(4,13)9(10,11)12/h5-6,13H2,1-4H3 |
| InChIKey | KNWVVMINOZWTJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |