C16H27N — CID 166671489
3-methyl-N-[(3E,5E)-2,6,7-trimethylocta-1,3,5-trien-3-yl]butan-2-imine (PubChem CID 166671489) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 3-methyl-N-[(3E,5E)-2,6,7-trimethylocta-1,3,5-trien-3-yl]butan-2-imine.
| Compound Name | 3-methyl-N-[(3E,5E)-2,6,7-trimethylocta-1,3,5-trien-3-yl]butan-2-imine |
|---|---|
| PubChem CID | 166671489 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 3-methyl-N-[(3E,5E)-2,6,7-trimethylocta-1,3,5-trien-3-yl]butan-2-imine |
| SMILES | C=C(C)C(=C\C=C(/C)C(C)C)/N=C(\C)C(C)C |
| InChI | InChI=1S/C16H27N/c1-11(2)14(7)9-10-16(13(5)6)17-15(8)12(3)4/h9-12H,5H2,1-4,6-8H3/b14-9+,16-10+,17-15+ |
| InChIKey | ASSAFUYACKYDGT-ZHMUIKMRSA-N |
| XLogP | 5.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|