C23H38O — CID 166671522
5-tert-butyl-1,3-dimethyl-2-[(E)-5,5,6,6-tetramethylhept-2-enoxy]benzene (PubChem CID 166671522) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is 5-tert-butyl-1,3-dimethyl-2-[(E)-5,5,6,6-tetramethylhept-2-enoxy]benzene.
| Compound Name | 5-tert-butyl-1,3-dimethyl-2-[(E)-5,5,6,6-tetramethylhept-2-enoxy]benzene |
|---|---|
| PubChem CID | 166671522 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 5-tert-butyl-1,3-dimethyl-2-[(E)-5,5,6,6-tetramethylhept-2-enoxy]benzene |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1OC/C=C/CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38O/c1-17-15-19(21(3,4)5)16-18(2)20(17)24-14-12-11-13-23(9,10)22(6,7)8/h11-12,15-16H,13-14H2,1-10H3/b12-11+ |
| InChIKey | MQGHGIQNWCYOQA-VAWYXSNFSA-N |
| XLogP | 7.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|