C10H21N3 — CID 166671629
(1R,6S,9R)-9-N-methyl-7-azabicyclo[4.2.2]decane-7,9-diamine (PubChem CID 166671629) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is (1R,6S,9R)-9-N-methyl-7-azabicyclo[4.2.2]decane-7,9-diamine.
| Compound Name | (1R,6S,9R)-9-N-methyl-7-azabicyclo[4.2.2]decane-7,9-diamine |
|---|---|
| PubChem CID | 166671629 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | (1R,6S,9R)-9-N-methyl-7-azabicyclo[4.2.2]decane-7,9-diamine |
| SMILES | CN[C@@H]1C[C@@H]2CCCC[C@@H]1CN2N |
| InChI | InChI=1S/C10H21N3/c1-12-10-6-9-5-3-2-4-8(10)7-13(9)11/h8-10,12H,2-7,11H2,1H3/t8-,9+,10-/m1/s1 |
| InChIKey | DVZAZWRBQFTSNI-KXUCPTDWSA-N |
| XLogP | 0.71 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|