C10H20F3NS — CID 166671911
1,1,1-trifluoro-3,3-dimethyl-N-(2-methylsulfanylpropan-2-yl)butan-2-amine (PubChem CID 166671911) has the molecular formula C10H20F3NS and a molecular weight of 243.34 g/mol. Its IUPAC name is 1,1,1-trifluoro-3,3-dimethyl-N-(2-methylsulfanylpropan-2-yl)butan-2-amine.
| Compound Name | 1,1,1-trifluoro-3,3-dimethyl-N-(2-methylsulfanylpropan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 166671911 |
| Molecular Formula | C10H20F3NS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1,1,1-trifluoro-3,3-dimethyl-N-(2-methylsulfanylpropan-2-yl)butan-2-amine |
| SMILES | CSC(C)(C)NC(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NS/c1-8(2,3)7(10(11,12)13)14-9(4,5)15-6/h7,14H,1-6H3 |
| InChIKey | IEKSQTDEJUOLCN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|