C15H22ClN5O3 — CID 166672161
6-[(1-acetylpiperidin-4-yl)amino]-N-(3-chloro-2-hydroxypropyl)pyrimidine-4-carboxamide (PubChem CID 166672161) has the molecular formula C15H22ClN5O3 and a molecular weight of 355.83 g/mol. Its IUPAC name is 6-[(1-acetylpiperidin-4-yl)amino]-N-(3-chloro-2-hydroxypropyl)pyrimidine-4-carboxamide.
| Compound Name | 6-[(1-acetylpiperidin-4-yl)amino]-N-(3-chloro-2-hydroxypropyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 166672161 |
| Molecular Formula | C15H22ClN5O3 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 6-[(1-acetylpiperidin-4-yl)amino]-N-(3-chloro-2-hydroxypropyl)pyrimidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(Nc2cc(C(=O)NCC(O)CCl)ncn2)CC1 |
| InChI | InChI=1S/C15H22ClN5O3/c1-10(22)21-4-2-11(3-5-21)20-14-6-13(18-9-19-14)15(24)17-8-12(23)7-16/h6,9,11-12,23H,2-5,7-8H2,1H3,(H,17,24)(H,18,19,20) |
| InChIKey | VSUWMKXLTJTOLS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|