C34H65NO5S — CID 166672548
[(2R)-3-(2-amino-4-methyl-3-oxo-4-propyldecyl)sulfanyl-2-(2,4,4-trimethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate (PubChem CID 166672548) has the molecular formula C34H65NO5S and a molecular weight of 599.96 g/mol. Its IUPAC name is [(2R)-3-(2-amino-4-methyl-3-oxo-4-propyldecyl)sulfanyl-2-(2,4,4-trimethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate.
| Compound Name | [(2R)-3-(2-amino-4-methyl-3-oxo-4-propyldecyl)sulfanyl-2-(2,4,4-trimethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 166672548 |
| Molecular Formula | C34H65NO5S |
| Molecular Weight | 599.96 g/mol |
| Exact Mass | 599.46 |
| IUPAC Name | [(2R)-3-(2-amino-4-methyl-3-oxo-4-propyldecyl)sulfanyl-2-(2,4,4-trimethylpentanoyloxy)propyl] 2,2,4,4-tetramethylpentanoate |
| SMILES | CCCCCCC(C)(CCC)C(=O)C(N)CSC[C@@H](COC(=O)C(C)(C)CC(C)(C)C)OC(=O)C(C)CC(C)(C)C |
| InChI | InChI=1S/C34H65NO5S/c1-13-15-16-17-19-34(12,18-14-2)28(36)27(35)23-41-22-26(40-29(37)25(3)20-31(4,5)6)21-39-30(38)33(10,11)24-32(7,8)9/h25-27H,13-24,35H2,1-12H3/t25?,26-,27?,34?/m1/s1 |
| InChIKey | RBHFZCNBHAPNCZ-ZCXJKHHISA-N |
| XLogP | 8.38 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.96 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|