C28H38F2N4O2 — CID 16667279
N-[4-[4-[2-(diethylamino)-1-(3-fluorophenyl)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide (PubChem CID 16667279) has the molecular formula C28H38F2N4O2 and a molecular weight of 500.63 g/mol. Its IUPAC name is N-[4-[4-[2-(diethylamino)-1-(3-fluorophenyl)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide.
| Compound Name | N-[4-[4-[2-(diethylamino)-1-(3-fluorophenyl)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 16667279 |
| Molecular Formula | C28H38F2N4O2 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.30 |
| IUPAC Name | N-[4-[4-[2-(diethylamino)-1-(3-fluorophenyl)-2-oxoethyl]piperazin-1-yl]-3-fluorophenyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C(C(=O)N(CC)CC)c3cccc(F)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H38F2N4O2/c1-5-20(6-2)27(35)31-23-12-13-25(24(30)19-23)33-14-16-34(17-15-33)26(28(36)32(7-3)8-4)21-10-9-11-22(29)18-21/h9-13,18-20,26H,5-8,14-17H2,1-4H3,(H,31,35) |
| InChIKey | NXXRIQQOANEECJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|