C29H31N5O3 — CID 16667291
17-methyl-20-oxa-4,14,17,23,26-pentazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione (PubChem CID 16667291) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is 17-methyl-20-oxa-4,14,17,23,26-pentazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione.
| Compound Name | 17-methyl-20-oxa-4,14,17,23,26-pentazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione |
|---|---|
| PubChem CID | 16667291 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 17-methyl-20-oxa-4,14,17,23,26-pentazahexacyclo[24.6.1.17,14.02,6.08,13.027,32]tetratriaconta-1(33),2(6),7(34),8,10,12,27,29,31-nonaene-3,5-dione |
| SMILES | CN1CCOCCNCCn2cc(c3ccccc32)C2=C(C(=O)NC2=O)c2cn(c3ccccc23)CC1 |
| InChI | InChI=1S/C29H31N5O3/c1-32-13-14-34-19-23(21-7-3-5-9-25(21)34)27-26(28(35)31-29(27)36)22-18-33(24-8-4-2-6-20(22)24)12-10-30-11-16-37-17-15-32/h2-9,18-19,30H,10-17H2,1H3,(H,31,35,36) |
| InChIKey | PEPHWTVWPXREAM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|