C27H40FIN6O3 — CID 166673462
tert-butyl 4-[8-[(1Z)-1-fluoro-3-iodobuta-1,3-dien-2-yl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazine-1-carboxylate (PubChem CID 166673462) has the molecular formula C27H40FIN6O3 and a molecular weight of 642.56 g/mol. Its IUPAC name is tert-butyl 4-[8-[(1Z)-1-fluoro-3-iodobuta-1,3-dien-2-yl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[8-[(1Z)-1-fluoro-3-iodobuta-1,3-dien-2-yl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166673462 |
| Molecular Formula | C27H40FIN6O3 |
| Molecular Weight | 642.56 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | tert-butyl 4-[8-[(1Z)-1-fluoro-3-iodobuta-1,3-dien-2-yl]-2-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]-5,6,7,9-tetrahydropyrimido[4,5-c]azepin-4-yl]piperazine-1-carboxylate |
| SMILES | C=C(I)/C(=C/F)N1CCCc2c(nc(OC[C@@H]3CCCN3C)nc2N2CCN(C(=O)OC(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C27H40FIN6O3/c1-19(29)23(16-28)35-11-7-9-21-22(17-35)30-25(37-18-20-8-6-10-32(20)5)31-24(21)33-12-14-34(15-13-33)26(36)38-27(2,3)4/h16,20H,1,6-15,17-18H2,2-5H3/b23-16-/t20-/m0/s1 |
| InChIKey | XVPFTDPDWSZROW-LORYXUCWSA-N |
| XLogP | 4.51 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|