C11H23NO4S — CID 166673768
(2S,3R,6R)-6,8-dihydroxy-3-prop-2-enyloctane-2-sulfonamide (PubChem CID 166673768) has the molecular formula C11H23NO4S and a molecular weight of 265.38 g/mol. Its IUPAC name is (2S,3R,6R)-6,8-dihydroxy-3-prop-2-enyloctane-2-sulfonamide.
| Compound Name | (2S,3R,6R)-6,8-dihydroxy-3-prop-2-enyloctane-2-sulfonamide |
|---|---|
| PubChem CID | 166673768 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S,3R,6R)-6,8-dihydroxy-3-prop-2-enyloctane-2-sulfonamide |
| SMILES | C=CC[C@@H](CC[C@@H](O)CCO)[C@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C11H23NO4S/c1-3-4-10(9(2)17(12,15)16)5-6-11(14)7-8-13/h3,9-11,13-14H,1,4-8H2,2H3,(H2,12,15,16)/t9-,10-,11+/m0/s1 |
| InChIKey | QFNHTNVDMJQEDP-GARJFASQSA-N |
| XLogP | 0.38 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|