C28H57NO2 — CID 166673784
2-[8-(3,7-dimethyloct-6-enoxy)-3,7,7,8-tetramethylnonoxy]-3-methylbutan-2-amine (PubChem CID 166673784) has the molecular formula C28H57NO2 and a molecular weight of 439.77 g/mol. Its IUPAC name is 2-[8-(3,7-dimethyloct-6-enoxy)-3,7,7,8-tetramethylnonoxy]-3-methylbutan-2-amine.
| Compound Name | 2-[8-(3,7-dimethyloct-6-enoxy)-3,7,7,8-tetramethylnonoxy]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 166673784 |
| Molecular Formula | C28H57NO2 |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 439.44 |
| IUPAC Name | 2-[8-(3,7-dimethyloct-6-enoxy)-3,7,7,8-tetramethylnonoxy]-3-methylbutan-2-amine |
| SMILES | CC(C)=CCCC(C)CCOC(C)(C)C(C)(C)CCCC(C)CCOC(C)(N)C(C)C |
| InChI | InChI=1S/C28H57NO2/c1-22(2)14-12-15-24(5)17-20-30-27(9,10)26(7,8)19-13-16-25(6)18-21-31-28(11,29)23(3)4/h14,23-25H,12-13,15-21,29H2,1-11H3 |
| InChIKey | ZLVQIAFSHNXRTP-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|