C28H55NO2 — CID 166674115
2-[6-[2-(5,9-dimethyldec-8-enoxy)-1,2,3-trimethylcyclopropyl]-3-methylhexoxy]propan-2-amine (PubChem CID 166674115) has the molecular formula C28H55NO2 and a molecular weight of 437.75 g/mol. Its IUPAC name is 2-[6-[2-(5,9-dimethyldec-8-enoxy)-1,2,3-trimethylcyclopropyl]-3-methylhexoxy]propan-2-amine.
| Compound Name | 2-[6-[2-(5,9-dimethyldec-8-enoxy)-1,2,3-trimethylcyclopropyl]-3-methylhexoxy]propan-2-amine |
|---|---|
| PubChem CID | 166674115 |
| Molecular Formula | C28H55NO2 |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 437.42 |
| IUPAC Name | 2-[6-[2-(5,9-dimethyldec-8-enoxy)-1,2,3-trimethylcyclopropyl]-3-methylhexoxy]propan-2-amine |
| SMILES | CC(C)=CCCC(C)CCCCOC1(C)C(C)C1(C)CCCC(C)CCOC(C)(C)N |
| InChI | InChI=1S/C28H55NO2/c1-22(2)14-12-16-23(3)15-10-11-20-31-28(9)25(5)27(28,8)19-13-17-24(4)18-21-30-26(6,7)29/h14,23-25H,10-13,15-21,29H2,1-9H3 |
| InChIKey | GKGGAIXAKPYNFG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|