About trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate
trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate (PubChem CID 166674197) has the molecular formula C12H22F2O2S
and a molecular weight of 268.37 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate |
| PubChem CID | 166674197 |
| Molecular Formula | C12H22F2O2S |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@H]1CS(F)(F)C(C)(C)C |
| InChI | InChI=1S/C12H22F2O2S/c1-11(2,3)17(13,14)8-9-6-7-12(9,4)10(15)16-5/h9H,6-8H2,1-5H3/t9-,12+/m0/s1 |
| InChIKey | UENSMAPPPZOICL-JOYOIKCWSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
The IUPAC name of trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate (CID 166674197) is trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate is COC(=O)[C@]1(C)CC[C@H]1CS(F)(F)C(C)(C)C.
What is the InChIKey of trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
The InChIKey is UENSMAPPPZOICL-JOYOIKCWSA-N. The full InChI is InChI=1S/C12H22F2O2S/c1-11(2,3)17(13,14)8-9-6-7-12(9,4)10(15)16-5/h9H,6-8H2,1-5H3/t9-,12+/m0/s1.
What are the key properties of trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate has a molecular weight of 268.37 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,2R)-2-[[tert-butyl(difluoro)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate is sourced from PubChem (CID 166674197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).