About trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate
trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate (PubChem CID 166674255) has the molecular formula C24H32O2S
and a molecular weight of 384.59 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate |
| PubChem CID | 166674255 |
| Molecular Formula | C24H32O2S |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@H]1CS(c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H32O2S/c1-23(2,3)27(20-12-8-6-9-13-20,21-14-10-7-11-15-21)18-19-16-17-24(19,4)22(25)26-5/h6-15,19H,16-18H2,1-5H3/t19-,24+/m0/s1 |
| InChIKey | DNAMSGLBHXRFBY-YADARESESA-N |
| XLogP | 6.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
The IUPAC name of trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate (CID 166674255) is trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate.
What is the SMILES notation for trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
The canonical SMILES for trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate is COC(=O)[C@]1(C)CC[C@H]1CS(c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
The InChIKey is DNAMSGLBHXRFBY-YADARESESA-N. The full InChI is InChI=1S/C24H32O2S/c1-23(2,3)27(20-12-8-6-9-13-20,21-14-10-7-11-15-21)18-19-16-17-24(19,4)22(25)26-5/h6-15,19H,16-18H2,1-5H3/t19-,24+/m0/s1.
What are the key properties of trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate?
trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate has a molecular weight of 384.59 g/mol, XLogP of 6.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-methyl (1R,2R)-2-[[tert-butyl(diphenyl)-λ4-sulfanyl]methyl]-1-methylcyclobutane-1-carboxylate is sourced from PubChem (CID 166674255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).