About S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine
S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine (PubChem CID 166674402) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine.
Molecular Properties
| Compound Name | S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine |
| PubChem CID | 166674402 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine |
| SMILES | C=CC[C@@H]1COCC[C@H]1SN |
| InChI | InChI=1S/C8H15NOS/c1-2-3-7-6-10-5-4-8(7)11-9/h2,7-8H,1,3-6,9H2/t7-,8-/m1/s1 |
| InChIKey | MATJZVCEISKHAV-HTQZYQBOSA-N |
| XLogP | 1.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine?
The IUPAC name of S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine (CID 166674402) is S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine.
What is the SMILES notation for S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine?
The canonical SMILES for S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine is C=CC[C@@H]1COCC[C@H]1SN.
What is the InChIKey of S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine?
The InChIKey is MATJZVCEISKHAV-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H15NOS/c1-2-3-7-6-10-5-4-8(7)11-9/h2,7-8H,1,3-6,9H2/t7-,8-/m1/s1.
What are the key properties of S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine?
S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine has a molecular weight of 173.28 g/mol, XLogP of 1.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(3R,4R)-3-prop-2-enyloxan-4-yl]thiohydroxylamine is sourced from PubChem (CID 166674402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).