C15H12Cl2N2O — CID 166675788
3,6-dichloro-4-(1-phenylethoxy)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 166675788) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is 3,6-dichloro-4-(1-phenylethoxy)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3,6-dichloro-4-(1-phenylethoxy)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 166675788 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 3,6-dichloro-4-(1-phenylethoxy)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(Oc1cc(Cl)nc2[nH]cc(Cl)c12)c1ccccc1 |
| InChI | InChI=1S/C15H12Cl2N2O/c1-9(10-5-3-2-4-6-10)20-12-7-13(17)19-15-14(12)11(16)8-18-15/h2-9H,1H3,(H,18,19) |
| InChIKey | UHAVUWHWDDKDEC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|