About [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane
[2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane (PubChem CID 166675932) has the molecular formula C20H17BrCl2NOPS
and a molecular weight of 501.21 g/mol. Its IUPAC name is [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane.
Molecular Properties
| Compound Name | [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane |
| PubChem CID | 166675932 |
| Molecular Formula | C20H17BrCl2NOPS |
| Molecular Weight | 501.21 g/mol |
| Exact Mass | 498.93 |
| IUPAC Name | [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane |
| SMILES | PCSc1cc(Cc2c(Cl)cc(Br)cc2Cl)ncc1OCc1ccccc1 |
| InChI | InChI=1S/C20H17BrCl2NOPS/c21-14-6-17(22)16(18(23)7-14)8-15-9-20(27-12-26)19(10-24-15)25-11-13-4-2-1-3-5-13/h1-7,9-10H,8,11-12,26H2 |
| InChIKey | RDFWFNSNOLKMDZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.21 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane?
The IUPAC name of [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane (CID 166675932) is [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane.
What is the SMILES notation for [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane?
The canonical SMILES for [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane is PCSc1cc(Cc2c(Cl)cc(Br)cc2Cl)ncc1OCc1ccccc1.
What is the InChIKey of [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane?
The InChIKey is RDFWFNSNOLKMDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17BrCl2NOPS/c21-14-6-17(22)16(18(23)7-14)8-15-9-20(27-12-26)19(10-24-15)25-11-13-4-2-1-3-5-13/h1-7,9-10H,8,11-12,26H2.
What are the key properties of [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane?
[2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane has a molecular weight of 501.21 g/mol, XLogP of 7.25, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-bromo-2,6-dichlorophenyl)methyl]-5-phenylmethoxy-4-pyridinyl]sulfanylmethylphosphane is sourced from PubChem (CID 166675932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).