About CID 166675955
CID 166675955 (PubChem CID 166675955) has the molecular formula C56H78O18
and a molecular weight of 1039.22 g/mol.
Molecular Properties
| Compound Name | CID 166675955 |
| PubChem CID | 166675955 |
| Molecular Formula | C56H78O18 |
| Molecular Weight | 1039.22 g/mol |
| Exact Mass | 1038.52 |
| IUPAC Name | — |
| SMILES | C=C1CC2CCC34CC5OC6C(OC7CCC(CC(=O)OC8CC9OC%10CC%11(CC%12OC%13(CCC%12O%11)CC(C)C%11OC(CO)C(O)CC%11O%13)OC%10CC9OC8CC8OC(CCC1O2)CC(C)C8=C)OC7C6O3)C5O4 |
| InChI | InChI=1S/C56H78O18/c1-25-13-29-5-7-33-26(2)14-31(60-33)9-11-55-23-45-50(73-55)51-52(67-45)53(74-55)49-35(66-51)8-6-30(62-49)15-47(59)65-40-18-38-39(63-37(40)17-36(61-29)28(25)4)19-41-43(64-38)21-56(70-41)22-44-34(69-56)10-12-54(72-44)20-27(3)48-42(71-54)16-32(58)46(24-57)68-48/h25,27,29-46,48-53,57-58H,2,4-24H2,1,3H3 |
| InChIKey | ZEOQMPNHRUPNJH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 195.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1039.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 166675955 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166675955?
The IUPAC name of CID 166675955 (CID 166675955) is not available.
What is the SMILES notation for CID 166675955?
The canonical SMILES for CID 166675955 is C=C1CC2CCC34CC5OC6C(OC7CCC(CC(=O)OC8CC9OC%10CC%11(CC%12OC%13(CCC%12O%11)CC(C)C%11OC(CO)C(O)CC%11O%13)OC%10CC9OC8CC8OC(CCC1O2)CC(C)C8=C)OC7C6O3)C5O4.
What is the InChIKey of CID 166675955?
The InChIKey is ZEOQMPNHRUPNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H78O18/c1-25-13-29-5-7-33-26(2)14-31(60-33)9-11-55-23-45-50(73-55)51-52(67-45)53(74-55)49-35(66-51)8-6-30(62-49)15-47(59)65-40-18-38-39(63-37(40)17-36(61-29)28(25)4)19-41-43(64-38)21-56(70-41)22-44-34(69-56)10-12-54(72-44)20-27(3)48-42(71-54)16-32(58)46(24-57)68-48/h25,27,29-46,48-53,57-58H,2,4-24H2,1,3H3.
What are the key properties of CID 166675955?
CID 166675955 has a molecular weight of 1039.22 g/mol, XLogP of 4.68, 1 rotatable bonds, 2 hydrogen bond donors, and 18 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166675955 is sourced from PubChem (CID 166675955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).