C14H29N — CID 166676044
(Z)-N,N,3,8-tetramethyldec-6-en-4-amine (PubChem CID 166676044) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is (Z)-N,N,3,8-tetramethyldec-6-en-4-amine.
| Compound Name | (Z)-N,N,3,8-tetramethyldec-6-en-4-amine |
|---|---|
| PubChem CID | 166676044 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (Z)-N,N,3,8-tetramethyldec-6-en-4-amine |
| SMILES | CCC(C)/C=C\CC(C(C)CC)N(C)C |
| InChI | InChI=1S/C14H29N/c1-7-12(3)10-9-11-14(15(5)6)13(4)8-2/h9-10,12-14H,7-8,11H2,1-6H3/b10-9- |
| InChIKey | BQJBEEHQEYKLOK-KTKRTIGZSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|