About (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine
(Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine (PubChem CID 166676062) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine.
Molecular Properties
| Compound Name | (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine |
| PubChem CID | 166676062 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine |
| SMILES | [H]/N=C/C=C(\N)CCC(C)(C)NC |
| InChI | InChI=1S/C9H19N3/c1-9(2,12-3)6-4-8(11)5-7-10/h5,7,10,12H,4,6,11H2,1-3H3/b8-5-,10-7+ |
| InChIKey | QRRGVOVNZNABAM-OEPUHGBTSA-N |
| XLogP | 1.26 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine?
The IUPAC name of (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine (CID 166676062) is (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine.
What is the SMILES notation for (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine?
The canonical SMILES for (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine is [H]/N=C/C=C(\N)CCC(C)(C)NC.
What is the InChIKey of (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine?
The InChIKey is QRRGVOVNZNABAM-OEPUHGBTSA-N. The full InChI is InChI=1S/C9H19N3/c1-9(2,12-3)6-4-8(11)5-7-10/h5,7,10,12H,4,6,11H2,1-3H3/b8-5-,10-7+.
What are the key properties of (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine?
(Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine has a molecular weight of 169.27 g/mol, XLogP of 1.26, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-7-imino-2-N,2-dimethylhept-5-ene-2,5-diamine is sourced from PubChem (CID 166676062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).