C15H30N2 — CID 166676167
(3E)-4-N-(2-ethylbutyl)-3-N,4-N-dimethylhepta-1,3-diene-3,4-diamine (PubChem CID 166676167) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is (3E)-4-N-(2-ethylbutyl)-3-N,4-N-dimethylhepta-1,3-diene-3,4-diamine.
| Compound Name | (3E)-4-N-(2-ethylbutyl)-3-N,4-N-dimethylhepta-1,3-diene-3,4-diamine |
|---|---|
| PubChem CID | 166676167 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | (3E)-4-N-(2-ethylbutyl)-3-N,4-N-dimethylhepta-1,3-diene-3,4-diamine |
| SMILES | C=C/C(NC)=C(/CCC)N(C)CC(CC)CC |
| InChI | InChI=1S/C15H30N2/c1-7-11-15(14(10-4)16-5)17(6)12-13(8-2)9-3/h10,13,16H,4,7-9,11-12H2,1-3,5-6H3/b15-14+ |
| InChIKey | UFXDZXVWJYMPHN-CCEZHUSRSA-N |
| XLogP | 3.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|