C13H18N2 — CID 166676186
2-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4,6-dimethylaniline (PubChem CID 166676186) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4,6-dimethylaniline.
| Compound Name | 2-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4,6-dimethylaniline |
|---|---|
| PubChem CID | 166676186 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 2-[(1Z,3E)-1-aminopenta-1,3-dien-3-yl]-4,6-dimethylaniline |
| SMILES | C/C=C(\C=C/N)c1cc(C)cc(C)c1N |
| InChI | InChI=1S/C13H18N2/c1-4-11(5-6-14)12-8-9(2)7-10(3)13(12)15/h4-8H,14-15H2,1-3H3/b6-5-,11-4+ |
| InChIKey | WIFHLETWCPGYCR-VWXLBWAMSA-N |
| XLogP | 2.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|