About CID 166676470
CID 166676470 (PubChem CID 166676470) has the molecular formula C22H29F2N2O4S2-
and a molecular weight of 487.61 g/mol.
Molecular Properties
| Compound Name | CID 166676470 |
| PubChem CID | 166676470 |
| Molecular Formula | C22H29F2N2O4S2- |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | — |
| SMILES | Cc1nc(C(C)(C)O)sc1/[S-](=O)=N/C(=O)Cc1c(C(C)C)cc(OC(F)F)cc1C(C)C |
| InChI | InChI=1S/C22H29F2N2O4S2/c1-11(2)15-8-14(30-21(23)24)9-16(12(3)4)17(15)10-18(27)26-32(29)19-13(5)25-20(31-19)22(6,7)28/h8-9,11-12,21,28H,10H2,1-7H3/q-1 |
| InChIKey | WKMBUKBWBITNNB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166676470 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166676470?
The IUPAC name of CID 166676470 (CID 166676470) is not available.
What is the SMILES notation for CID 166676470?
The canonical SMILES for CID 166676470 is Cc1nc(C(C)(C)O)sc1/[S-](=O)=N/C(=O)Cc1c(C(C)C)cc(OC(F)F)cc1C(C)C.
What is the InChIKey of CID 166676470?
The InChIKey is WKMBUKBWBITNNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29F2N2O4S2/c1-11(2)15-8-14(30-21(23)24)9-16(12(3)4)17(15)10-18(27)26-32(29)19-13(5)25-20(31-19)22(6,7)28/h8-9,11-12,21,28H,10H2,1-7H3/q-1.
What are the key properties of CID 166676470?
CID 166676470 has a molecular weight of 487.61 g/mol, XLogP of 5.80, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166676470 is sourced from PubChem (CID 166676470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).