C23H38N4O11 — CID 166676879
(2R,3R,4S)-3-acetamido-4-[[N'-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]carbamimidoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 166676879) has the molecular formula C23H38N4O11 and a molecular weight of 546.57 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-[[N'-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]carbamimidoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3-acetamido-4-[[N'-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]carbamimidoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 166676879 |
| Molecular Formula | C23H38N4O11 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-[[N'-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]carbamimidoyl]amino]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | C#CCOCCOCCOCCOCC/N=C(\N)N[C@H]1C=C(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C23H38N4O11/c1-3-5-34-7-9-36-11-12-37-10-8-35-6-4-25-23(24)27-16-13-18(22(32)33)38-21(19(16)26-15(2)29)20(31)17(30)14-28/h1,13,16-17,19-21,28,30-31H,4-12,14H2,2H3,(H,26,29)(H,32,33)(H3,24,25,27)/t16-,17+,19+,20+,21+/m0/s1 |
| InChIKey | DXBYPQTUOLLRSQ-MIGBRYPXSA-N |
| XLogP | -3.45 |
| TPSA | 223.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|