C29H18FNO2S — CID 166677781
2-[(17-fluoro-7,7-dimethyl-3-thia-1-azapentacyclo[10.6.1.02,6.08,19.013,18]nonadeca-2(6),4,8,10,12(19),13(18),14,16-octaen-4-yl)methylidene]indene-1,3-dione (PubChem CID 166677781) has the molecular formula C29H18FNO2S and a molecular weight of 463.53 g/mol. Its IUPAC name is 2-[(17-fluoro-7,7-dimethyl-3-thia-1-azapentacyclo[10.6.1.02,6.08,19.013,18]nonadeca-2(6),4,8,10,12(19),13(18),14,16-octaen-4-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(17-fluoro-7,7-dimethyl-3-thia-1-azapentacyclo[10.6.1.02,6.08,19.013,18]nonadeca-2(6),4,8,10,12(19),13(18),14,16-octaen-4-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 166677781 |
| Molecular Formula | C29H18FNO2S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[(17-fluoro-7,7-dimethyl-3-thia-1-azapentacyclo[10.6.1.02,6.08,19.013,18]nonadeca-2(6),4,8,10,12(19),13(18),14,16-octaen-4-yl)methylidene]indene-1,3-dione |
| SMILES | CC1(C)c2cc(C=C3C(=O)c4ccccc4C3=O)sc2-n2c3c(F)cccc3c3cccc1c32 |
| InChI | InChI=1S/C29H18FNO2S/c1-29(2)21-11-5-9-16-17-10-6-12-23(30)25(17)31(24(16)21)28-22(29)14-15(34-28)13-20-26(32)18-7-3-4-8-19(18)27(20)33/h3-14H,1-2H3 |
| InChIKey | QKSIMMYPONCDLB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|