C19H14ClN7O — CID 16667807
5-[(2-chlorophenyl)methyl]-10-(4-methoxyphenyl)-3,4,5,7,9,11,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaene (PubChem CID 16667807) has the molecular formula C19H14ClN7O and a molecular weight of 391.82 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-10-(4-methoxyphenyl)-3,4,5,7,9,11,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaene.
| Compound Name | 5-[(2-chlorophenyl)methyl]-10-(4-methoxyphenyl)-3,4,5,7,9,11,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaene |
|---|---|
| PubChem CID | 16667807 |
| Molecular Formula | C19H14ClN7O |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-10-(4-methoxyphenyl)-3,4,5,7,9,11,12-heptazatricyclo[7.3.0.02,6]dodeca-1(12),2(6),3,7,10-pentaene |
| SMILES | COc1ccc(-c2nnc3c4nnn(Cc5ccccc5Cl)c4ncn23)cc1 |
| InChI | InChI=1S/C19H14ClN7O/c1-28-14-8-6-12(7-9-14)17-23-24-19-16-18(21-11-26(17)19)27(25-22-16)10-13-4-2-3-5-15(13)20/h2-9,11H,10H2,1H3 |
| InChIKey | WRZXIZZHUYEKHD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |