C18H27ClFN — CID 166678270
3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-ethyl-4-methyl-1-azaspiro[4.5]decane (PubChem CID 166678270) has the molecular formula C18H27ClFN and a molecular weight of 311.87 g/mol. Its IUPAC name is 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-ethyl-4-methyl-1-azaspiro[4.5]decane.
| Compound Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-ethyl-4-methyl-1-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 166678270 |
| Molecular Formula | C18H27ClFN |
| Molecular Weight | 311.87 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-ethyl-4-methyl-1-azaspiro[4.5]decane |
| SMILES | C=C(Cl)/C=C\C=C(/F)C1CN(CC)C2(CCCCC2)C1C |
| InChI | InChI=1S/C18H27ClFN/c1-4-21-13-16(17(20)10-8-9-14(2)19)15(3)18(21)11-6-5-7-12-18/h8-10,15-16H,2,4-7,11-13H2,1,3H3/b9-8-,17-10- |
| InChIKey | GCOVKCFVMJNGRY-MWXTUPAHSA-N |
| XLogP | 5.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.87 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|