C10H18N2 — CID 166678478
N-ethyl-N'-(3-methylbut-1-en-2-yl)prop-1-yne-1,3-diamine (PubChem CID 166678478) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-ethyl-N'-(3-methylbut-1-en-2-yl)prop-1-yne-1,3-diamine.
| Compound Name | N-ethyl-N'-(3-methylbut-1-en-2-yl)prop-1-yne-1,3-diamine |
|---|---|
| PubChem CID | 166678478 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-ethyl-N'-(3-methylbut-1-en-2-yl)prop-1-yne-1,3-diamine |
| SMILES | C=C(NCC#CNCC)C(C)C |
| InChI | InChI=1S/C10H18N2/c1-5-11-7-6-8-12-10(4)9(2)3/h9,11-12H,4-5,8H2,1-3H3 |
| InChIKey | QPKGQPZQXALNTL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|