C7H12O4 — CID 166679986
(1S,2S,3R)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 166679986) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (1S,2S,3R)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3R)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 166679986 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (1S,2S,3R)-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | OCC1=CC[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12O4/c8-3-4-1-2-5(9)7(11)6(4)10/h1,5-11H,2-3H2/t5-,6+,7-/m0/s1 |
| InChIKey | DGTCAQILTSGIAR-XVMARJQXSA-N |
| XLogP | -1.61 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|