C30H35Cl2F3N2O6S — CID 166680013
2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-2,5-dimethyl-6-[(2,2,2-trifluoroacetyl)sulfamoyl]hexan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid (PubChem CID 166680013) has the molecular formula C30H35Cl2F3N2O6S and a molecular weight of 679.59 g/mol. Its IUPAC name is 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-2,5-dimethyl-6-[(2,2,2-trifluoroacetyl)sulfamoyl]hexan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-2,5-dimethyl-6-[(2,2,2-trifluoroacetyl)sulfamoyl]hexan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 166680013 |
| Molecular Formula | C30H35Cl2F3N2O6S |
| Molecular Weight | 679.59 g/mol |
| Exact Mass | 678.15 |
| IUPAC Name | 2-[(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-[(3S)-2,5-dimethyl-6-[(2,2,2-trifluoroacetyl)sulfamoyl]hexan-3-yl]-3-methyl-2-oxopiperidin-3-yl]acetic acid |
| SMILES | CC(C[C@@H](C(C)C)N1C(=O)[C@@](C)(CC(=O)O)C[C@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1)CS(=O)(=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C30H35Cl2F3N2O6S/c1-17(2)24(12-18(3)16-44(42,43)36-27(40)30(33,34)35)37-26(19-8-10-21(31)11-9-19)23(20-6-5-7-22(32)13-20)14-29(4,28(37)41)15-25(38)39/h5-11,13,17-18,23-24,26H,12,14-16H2,1-4H3,(H,36,40)(H,38,39)/t18?,23-,24+,26-,29-/m1/s1 |
| InChIKey | PLQSOWSKGWXCCB-PYPLSWBYSA-N |
| XLogP | 6.59 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.59 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |