C21H35N5O — CID 166680900
2-[4-[3-(dimethylamino)propyl-methylamino]phenyl]-N-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 166680900) has the molecular formula C21H35N5O and a molecular weight of 373.55 g/mol. Its IUPAC name is 2-[4-[3-(dimethylamino)propyl-methylamino]phenyl]-N-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 2-[4-[3-(dimethylamino)propyl-methylamino]phenyl]-N-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 166680900 |
| Molecular Formula | C21H35N5O |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | 2-[4-[3-(dimethylamino)propyl-methylamino]phenyl]-N-ethyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | CCNC(=O)N1CC2CN(c3ccc(N(C)CCCN(C)C)cc3)CC2C1 |
| InChI | InChI=1S/C21H35N5O/c1-5-22-21(27)26-15-17-13-25(14-18(17)16-26)20-9-7-19(8-10-20)24(4)12-6-11-23(2)3/h7-10,17-18H,5-6,11-16H2,1-4H3,(H,22,27) |
| InChIKey | LJQIUDKKPNLWTK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|