C13H19F12N4O8S4+ — CID 166681147
1-methyl-3-pentylimidazol-1-ium;bis(1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide) (PubChem CID 166681147) has the molecular formula C13H19F12N4O8S4+ and a molecular weight of 715.56 g/mol. Its IUPAC name is 1-methyl-3-pentylimidazol-1-ium;bis(1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide).
| Compound Name | 1-methyl-3-pentylimidazol-1-ium;bis(1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide) |
|---|---|
| PubChem CID | 166681147 |
| Molecular Formula | C13H19F12N4O8S4+ |
| Molecular Weight | 715.56 g/mol |
| Exact Mass | 714.99 |
| IUPAC Name | 1-methyl-3-pentylimidazol-1-ium;bis(1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide) |
| SMILES | CCCCCn1cc[n+](C)c1.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H17N2.2C2HF6NO4S2/c1-3-4-5-6-11-8-7-10(2)9-11;2*3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-9H,3-6H2,1-2H3;2*9H/q+1;; |
| InChIKey | MJZZNBCEPPQYKV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 169.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.56 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|