C22H30N8O3 — CID 166681467
[7-(butylamino)-1-[(4-methoxy-6-piperidin-4-yl-3-pyridinyl)methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamic acid (PubChem CID 166681467) has the molecular formula C22H30N8O3 and a molecular weight of 454.54 g/mol. Its IUPAC name is [7-(butylamino)-1-[(4-methoxy-6-piperidin-4-yl-3-pyridinyl)methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamic acid.
| Compound Name | [7-(butylamino)-1-[(4-methoxy-6-piperidin-4-yl-3-pyridinyl)methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamic acid |
|---|---|
| PubChem CID | 166681467 |
| Molecular Formula | C22H30N8O3 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [7-(butylamino)-1-[(4-methoxy-6-piperidin-4-yl-3-pyridinyl)methyl]pyrazolo[4,5-d]pyrimidin-5-yl]carbamic acid |
| SMILES | CCCCNc1nc(NC(=O)O)nc2cnn(Cc3cnc(C4CCNCC4)cc3OC)c12 |
| InChI | InChI=1S/C22H30N8O3/c1-3-4-7-24-20-19-17(27-21(28-20)29-22(31)32)12-26-30(19)13-15-11-25-16(10-18(15)33-2)14-5-8-23-9-6-14/h10-12,14,23H,3-9,13H2,1-2H3,(H,31,32)(H2,24,27,28,29) |
| InChIKey | FAFISAVILYPCGE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|