C20H19N5S — CID 16668160
11-methyl-N-(pyridin-3-ylmethyl)-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 16668160) has the molecular formula C20H19N5S and a molecular weight of 361.47 g/mol. Its IUPAC name is 11-methyl-N-(pyridin-3-ylmethyl)-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 11-methyl-N-(pyridin-3-ylmethyl)-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 16668160 |
| Molecular Formula | C20H19N5S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 11-methyl-N-(pyridin-3-ylmethyl)-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | Cc1nn2c(NCc3cccnc3)c3c(nc2c1-c1cccs1)CCC3 |
| InChI | InChI=1S/C20H19N5S/c1-13-18(17-8-4-10-26-17)20-23-16-7-2-6-15(16)19(25(20)24-13)22-12-14-5-3-9-21-11-14/h3-5,8-11,22H,2,6-7,12H2,1H3 |
| InChIKey | FYLIPIZPECCFEF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |