C17H20N4OS — CID 16668166
3-[(11-methyl-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]propan-1-ol (PubChem CID 16668166) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-[(11-methyl-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]propan-1-ol.
| Compound Name | 3-[(11-methyl-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 16668166 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-[(11-methyl-10-thiophen-2-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl)amino]propan-1-ol |
| SMILES | Cc1nn2c(NCCCO)c3c(nc2c1-c1cccs1)CCC3 |
| InChI | InChI=1S/C17H20N4OS/c1-11-15(14-7-3-10-23-14)17-19-13-6-2-5-12(13)16(21(17)20-11)18-8-4-9-22/h3,7,10,18,22H,2,4-6,8-9H2,1H3 |
| InChIKey | HEVZLOUCBOLMSK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|