C22H37ClF3N5O4 — CID 166681944
(2R,3R,4R,5S)-5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-(11,11-diaminoundecoxymethyl)oxane-3,4-diol (PubChem CID 166681944) has the molecular formula C22H37ClF3N5O4 and a molecular weight of 528.02 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-(11,11-diaminoundecoxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-(11,11-diaminoundecoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 166681944 |
| Molecular Formula | C22H37ClF3N5O4 |
| Molecular Weight | 528.02 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (2R,3R,4R,5S)-5-[[6-chloro-2-(trifluoromethyl)pyrimidin-4-yl]amino]-2-(11,11-diaminoundecoxymethyl)oxane-3,4-diol |
| SMILES | NC(N)CCCCCCCCCCOC[C@H]1OC[C@H](Nc2cc(Cl)nc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H37ClF3N5O4/c23-16-11-18(31-21(30-16)22(24,25)26)29-14-12-35-15(20(33)19(14)32)13-34-10-8-6-4-2-1-3-5-7-9-17(27)28/h11,14-15,17,19-20,32-33H,1-10,12-13,27-28H2,(H,29,30,31)/t14-,15+,19+,20-/m0/s1 |
| InChIKey | VSQYBYJMCRKICB-BWMZKYQQSA-N |
| XLogP | 2.82 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|