About 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone
1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 16668217) has the molecular formula C20H20FNO3
and a molecular weight of 341.38 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone.
Molecular Properties
| Compound Name | 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone |
| PubChem CID | 16668217 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCC(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H20FNO3/c21-17-4-1-14(2-5-17)11-20(23)22-9-7-15(8-10-22)16-3-6-18-19(12-16)25-13-24-18/h1-6,12,15H,7-11,13H2 |
| InChIKey | BICLPWDEDWSGFD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone?
The IUPAC name of 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone (CID 16668217) is 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone.
What is the SMILES notation for 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone?
The canonical SMILES for 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone is O=C(Cc1ccc(F)cc1)N1CCC(c2ccc3c(c2)OCO3)CC1.
What is the InChIKey of 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone?
The InChIKey is BICLPWDEDWSGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FNO3/c21-17-4-1-14(2-5-17)11-20(23)22-9-7-15(8-10-22)16-3-6-18-19(12-16)25-13-24-18/h1-6,12,15H,7-11,13H2.
What are the key properties of 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone?
1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone has a molecular weight of 341.38 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,3-benzodioxol-5-yl)piperidin-1-yl]-2-(4-fluorophenyl)ethanone is sourced from PubChem (CID 16668217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).