C10H17NO5 — CID 166682251
1-[(3aR,5R,6R,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone (PubChem CID 166682251) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone.
| Compound Name | 1-[(3aR,5R,6R,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone |
|---|---|
| PubChem CID | 166682251 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-[(3aR,5R,6R,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]21 |
| InChI | InChI=1S/C10H17NO5/c1-5(13)11-3-2-6-8(11)10(15)9(14)7(4-12)16-6/h6-10,12,14-15H,2-4H2,1H3/t6-,7-,8+,9+,10-/m1/s1 |
| InChIKey | VDYMMWMDQVLXFL-FHNUBNKASA-N |
| XLogP | -1.91 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |