C18H21NS — CID 166682417
N-ethenyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-2-propan-2-ylidenethiophen-3-imine (PubChem CID 166682417) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is N-ethenyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-2-propan-2-ylidenethiophen-3-imine.
| Compound Name | N-ethenyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-2-propan-2-ylidenethiophen-3-imine |
|---|---|
| PubChem CID | 166682417 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-ethenyl-5-[(1E,3Z,6Z)-5-methylcycloocta-1,3,6-trien-1-yl]-2-propan-2-ylidenethiophen-3-imine |
| SMILES | C=C/N=C1\C=C(/C2=C/C=C\C(C)/C=C\C2)SC1=C(C)C |
| InChI | InChI=1S/C18H21NS/c1-5-19-16-12-17(20-18(16)13(2)3)15-10-6-8-14(4)9-7-11-15/h5-10,12,14H,1,11H2,2-4H3/b8-6-,9-7-,15-10+,19-16+ |
| InChIKey | QCROPWTWPGSYHN-OYFVEVOYSA-N |
| XLogP | 5.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|