C17H32N2O — CID 166682565
(1S)-1-[1-[(1E,3Z)-1-amino-5-ethyl-6-methylhepta-1,3-dien-2-yl]piperidin-4-yl]ethanol (PubChem CID 166682565) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is (1S)-1-[1-[(1E,3Z)-1-amino-5-ethyl-6-methylhepta-1,3-dien-2-yl]piperidin-4-yl]ethanol.
| Compound Name | (1S)-1-[1-[(1E,3Z)-1-amino-5-ethyl-6-methylhepta-1,3-dien-2-yl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 166682565 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | (1S)-1-[1-[(1E,3Z)-1-amino-5-ethyl-6-methylhepta-1,3-dien-2-yl]piperidin-4-yl]ethanol |
| SMILES | CCC(/C=C\C(=C/N)N1CCC([C@H](C)O)CC1)C(C)C |
| InChI | InChI=1S/C17H32N2O/c1-5-15(13(2)3)6-7-17(12-18)19-10-8-16(9-11-19)14(4)20/h6-7,12-16,20H,5,8-11,18H2,1-4H3/b7-6-,17-12+/t14-,15?/m0/s1 |
| InChIKey | GONOIGQTPBVSPM-BYBDTNKXSA-N |
| XLogP | 3.12 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|