About (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine
(4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine (PubChem CID 166682652) has the molecular formula C9H18F2N2S
and a molecular weight of 224.32 g/mol. Its IUPAC name is (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine |
| PubChem CID | 166682652 |
| Molecular Formula | C9H18F2N2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine |
| SMILES | CN[C@H]1CCN(C(C)SC)CC1(F)F |
| InChI | InChI=1S/C9H18F2N2S/c1-7(14-3)13-5-4-8(12-2)9(10,11)6-13/h7-8,12H,4-6H2,1-3H3/t7?,8-/m0/s1 |
| InChIKey | XVIJMVICONIIPN-MQWKRIRWSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine?
The IUPAC name of (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine (CID 166682652) is (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine.
What is the SMILES notation for (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine?
The canonical SMILES for (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine is CN[C@H]1CCN(C(C)SC)CC1(F)F.
What is the InChIKey of (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine?
The InChIKey is XVIJMVICONIIPN-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H18F2N2S/c1-7(14-3)13-5-4-8(12-2)9(10,11)6-13/h7-8,12H,4-6H2,1-3H3/t7?,8-/m0/s1.
What are the key properties of (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine?
(4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine has a molecular weight of 224.32 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,3-difluoro-N-methyl-1-(1-methylsulfanylethyl)piperidin-4-amine is sourced from PubChem (CID 166682652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).