C16H28N2O — CID 166682670
(1E,3Z,5Z)-2-(4-methoxypiperidin-1-yl)-5-propan-2-ylhepta-1,3,5-trien-1-amine (PubChem CID 166682670) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (1E,3Z,5Z)-2-(4-methoxypiperidin-1-yl)-5-propan-2-ylhepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-2-(4-methoxypiperidin-1-yl)-5-propan-2-ylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 166682670 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (1E,3Z,5Z)-2-(4-methoxypiperidin-1-yl)-5-propan-2-ylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C(\C=C/C(=C\N)N1CCC(OC)CC1)C(C)C |
| InChI | InChI=1S/C16H28N2O/c1-5-14(13(2)3)6-7-15(12-17)18-10-8-16(19-4)9-11-18/h5-7,12-13,16H,8-11,17H2,1-4H3/b7-6-,14-5+,15-12+ |
| InChIKey | DQOSDMFNFSUWRO-NYKSKJPQSA-N |
| XLogP | 3.06 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|