C20H26N4O2 — CID 166682767
(Z,2E)-4-amino-2-(aminomethylidene)-N-[[3-methyl-2-(oxan-4-yl)-1H-indol-5-yl]methyl]but-3-enamide (PubChem CID 166682767) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (Z,2E)-4-amino-2-(aminomethylidene)-N-[[3-methyl-2-(oxan-4-yl)-1H-indol-5-yl]methyl]but-3-enamide.
| Compound Name | (Z,2E)-4-amino-2-(aminomethylidene)-N-[[3-methyl-2-(oxan-4-yl)-1H-indol-5-yl]methyl]but-3-enamide |
|---|---|
| PubChem CID | 166682767 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (Z,2E)-4-amino-2-(aminomethylidene)-N-[[3-methyl-2-(oxan-4-yl)-1H-indol-5-yl]methyl]but-3-enamide |
| SMILES | Cc1c(C2CCOCC2)[nH]c2ccc(CNC(=O)C(/C=C\N)=C/N)cc12 |
| InChI | InChI=1S/C20H26N4O2/c1-13-17-10-14(12-23-20(25)16(11-22)4-7-21)2-3-18(17)24-19(13)15-5-8-26-9-6-15/h2-4,7,10-11,15,24H,5-6,8-9,12,21-22H2,1H3,(H,23,25)/b7-4-,16-11+ |
| InChIKey | JMNZAPMBSXADMS-SWMCFQLFSA-N |
| XLogP | 2.30 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|