C22H24FN5O — CID 16668280
1-[4-[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]piperazin-1-yl]ethanone (PubChem CID 16668280) has the molecular formula C22H24FN5O and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[4-[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 16668280 |
| Molecular Formula | C22H24FN5O |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-[4-[10-(4-fluorophenyl)-11-methyl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2c3c(nc4c(-c5ccc(F)cc5)c(C)nn24)CCC3)CC1 |
| InChI | InChI=1S/C22H24FN5O/c1-14-20(16-6-8-17(23)9-7-16)21-24-19-5-3-4-18(19)22(28(21)25-14)27-12-10-26(11-13-27)15(2)29/h6-9H,3-5,10-13H2,1-2H3 |
| InChIKey | WGEDATYPFZWJHK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |